C14H21N7O9S3 — CID 59664367
3-[[4-(2-hydroxyethylamino)-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid (PubChem CID 59664367) has the molecular formula C14H21N7O9S3 and a molecular weight of 527.56 g/mol. Its IUPAC name is 3-[[4-(2-hydroxyethylamino)-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid.
| Compound Name | 3-[[4-(2-hydroxyethylamino)-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
|---|---|
| PubChem CID | 59664367 |
| Molecular Formula | C14H21N7O9S3 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 3-[[4-(2-hydroxyethylamino)-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(NCCO)nc(Nc2cc(S(=O)(=O)O)ccc2OS(=O)O)n1 |
| InChI | InChI=1S/C14H21N7O9S3/c1-32(25,26)17-5-4-15-12-19-13(16-6-7-22)21-14(20-12)18-10-8-9(33(27,28)29)2-3-11(10)30-31(23)24/h2-3,8,17,22H,4-7H2,1H3,(H,23,24)(H,27,28,29)(H3,15,16,18,19,20,21) |
| InChIKey | SBHHZDZPZBEAAZ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 242.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|