C14H21N7O11S4 — CID 59664372
3-[[4-[2-(methanesulfonamido)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid (PubChem CID 59664372) has the molecular formula C14H21N7O11S4 and a molecular weight of 591.63 g/mol. Its IUPAC name is 3-[[4-[2-(methanesulfonamido)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid.
| Compound Name | 3-[[4-[2-(methanesulfonamido)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
|---|---|
| PubChem CID | 59664372 |
| Molecular Formula | C14H21N7O11S4 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | 3-[[4-[2-(methanesulfonamido)ethylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(NCCS(=O)(=O)O)nc(Nc2cc(S(=O)(=O)O)ccc2OS(=O)O)n1 |
| InChI | InChI=1S/C14H21N7O11S4/c1-34(24,25)17-5-4-15-12-19-13(16-6-7-35(26,27)28)21-14(20-12)18-10-8-9(36(29,30)31)2-3-11(10)32-33(22)23/h2-3,8,17H,4-7H2,1H3,(H,22,23)(H,26,27,28)(H,29,30,31)(H3,15,16,18,19,20,21) |
| InChIKey | AVVSDZJHONGRHZ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 276.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|