About [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol
[(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol (PubChem CID 59664739) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol |
| PubChem CID | 59664739 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol |
| SMILES | OCC1NCC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H15NO/c12-5-9-10-7-2-1-6(3-7)8(10)4-11-9/h1-2,6-12H,3-5H2 |
| InChIKey | ZQFHSFBQHDWKIO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol?
The IUPAC name of [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol (CID 59664739) is [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol.
What is the SMILES notation for [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol?
The canonical SMILES for [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol is OCC1NCC2C3C=CC(C3)C12.
What is the InChIKey of [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol?
The InChIKey is ZQFHSFBQHDWKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-5-9-10-7-2-1-6(3-7)8(10)4-11-9/h1-2,6-12H,3-5H2.
What are the key properties of [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol?
[(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol has a molecular weight of 165.24 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol is sourced from PubChem (CID 59664739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).