C34H29F3N2O3 — CID 59664803
3-cyclohexyl-18-[3-(trifluoromethoxy)phenyl]-10,19-diazapentacyclo[12.8.0.02,10.04,9.015,20]docosa-1(14),2,4(9),5,7,15(20),16,18,21-nonaene-7-carboxylic acid (PubChem CID 59664803) has the molecular formula C34H29F3N2O3 and a molecular weight of 570.61 g/mol. Its IUPAC name is 3-cyclohexyl-18-[3-(trifluoromethoxy)phenyl]-10,19-diazapentacyclo[12.8.0.02,10.04,9.015,20]docosa-1(14),2,4(9),5,7,15(20),16,18,21-nonaene-7-carboxylic acid.
| Compound Name | 3-cyclohexyl-18-[3-(trifluoromethoxy)phenyl]-10,19-diazapentacyclo[12.8.0.02,10.04,9.015,20]docosa-1(14),2,4(9),5,7,15(20),16,18,21-nonaene-7-carboxylic acid |
|---|---|
| PubChem CID | 59664803 |
| Molecular Formula | C34H29F3N2O3 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 3-cyclohexyl-18-[3-(trifluoromethoxy)phenyl]-10,19-diazapentacyclo[12.8.0.02,10.04,9.015,20]docosa-1(14),2,4(9),5,7,15(20),16,18,21-nonaene-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CCCc1c-3ccc2nc(-c3cccc(OC(F)(F)F)c3)ccc12 |
| InChI | InChI=1S/C34H29F3N2O3/c35-34(36,37)42-23-9-4-8-21(18-23)28-15-13-25-24-10-5-17-39-30-19-22(33(40)41)11-12-27(30)31(20-6-2-1-3-7-20)32(39)26(24)14-16-29(25)38-28/h4,8-9,11-16,18-20H,1-3,5-7,10,17H2,(H,40,41) |
| InChIKey | SFLSDVKZDZAHND-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |