C30H30N4O2S — CID 59664806
methyl 2-[5-amino-2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-3-cyclohexyl-1H-indole-6-carboxylate (PubChem CID 59664806) has the molecular formula C30H30N4O2S and a molecular weight of 510.66 g/mol. Its IUPAC name is methyl 2-[5-amino-2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-3-cyclohexyl-1H-indole-6-carboxylate.
| Compound Name | methyl 2-[5-amino-2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-3-cyclohexyl-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 59664806 |
| Molecular Formula | C30H30N4O2S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | methyl 2-[5-amino-2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-3-cyclohexyl-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccc4nc(-c5sc(C)nc5C)ccc4c3N)[nH]c2c1 |
| InChI | InChI=1S/C30H30N4O2S/c1-16-29(37-17(2)32-16)24-14-11-21-23(33-24)13-12-22(27(21)31)28-26(18-7-5-4-6-8-18)20-10-9-19(30(35)36-3)15-25(20)34-28/h9-15,18,34H,4-8,31H2,1-3H3 |
| InChIKey | LSWLZQRDGAIHJV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|