C19H16N6S — CID 59665133
3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 59665133) has the molecular formula C19H16N6S and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 59665133 |
| Molecular Formula | C19H16N6S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1ccc(C2=Nn3c(nnc3-c3c(C)nc4ccccn34)SC2)cc1 |
| InChI | InChI=1S/C19H16N6S/c1-12-6-8-14(9-7-12)15-11-26-19-22-21-18(25(19)23-15)17-13(2)20-16-5-3-4-10-24(16)17/h3-10H,11H2,1-2H3 |
| InChIKey | BTUOEQCATNGTGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |