C24H27N3O5S — CID 59665686
(3S)-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide (PubChem CID 59665686) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is (3S)-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 59665686 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (3S)-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@H]1CCNC1)C(=O)NS(=O)(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-2-19-14-24(19,26-22(28)18-11-12-25-15-18)23(29)27-33(30,31)21-10-6-9-20(13-21)32-16-17-7-4-3-5-8-17/h2-10,13,18-19,25H,1,11-12,14-16H2,(H,26,28)(H,27,29)/t18-,19+,24+/m0/s1 |
| InChIKey | VKZVHRCKCZVDSJ-XLNZFTOWSA-N |
| XLogP | 1.74 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|