C38H39N3O5S — CID 59665699
(4S)-1,4-dibenzyl-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide (PubChem CID 59665699) has the molecular formula C38H39N3O5S and a molecular weight of 649.81 g/mol. Its IUPAC name is (4S)-1,4-dibenzyl-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide.
| Compound Name | (4S)-1,4-dibenzyl-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 59665699 |
| Molecular Formula | C38H39N3O5S |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.26 |
| IUPAC Name | (4S)-1,4-dibenzyl-N-[(1R,2S)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]pyrrolidine-3-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)C1CN(Cc2ccccc2)C[C@H]1Cc1ccccc1)C(=O)NS(=O)(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C38H39N3O5S/c1-2-32-23-38(32,37(43)40-47(44,45)34-20-12-19-33(22-34)46-27-30-17-10-5-11-18-30)39-36(42)35-26-41(24-29-15-8-4-9-16-29)25-31(35)21-28-13-6-3-7-14-28/h2-20,22,31-32,35H,1,21,23-27H2,(H,39,42)(H,40,43)/t31-,32-,35?,38-/m1/s1 |
| InChIKey | POOAGZBGDPWVAQ-LTWKOVNKSA-N |
| XLogP | 5.12 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|