C23H24N2O4S — CID 59665732
cis-(1S,2S)-N-[(3-benzyl-2-oxo-3,4-dihydro-1H-quinolin-8-yl)sulfonyl]-2-ethenyl-1-methylcyclopropane-1-carboxamide (PubChem CID 59665732) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is cis-(1S,2S)-N-[(3-benzyl-2-oxo-3,4-dihydro-1H-quinolin-8-yl)sulfonyl]-2-ethenyl-1-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[(3-benzyl-2-oxo-3,4-dihydro-1H-quinolin-8-yl)sulfonyl]-2-ethenyl-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59665732 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | cis-(1S,2S)-N-[(3-benzyl-2-oxo-3,4-dihydro-1H-quinolin-8-yl)sulfonyl]-2-ethenyl-1-methylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1cccc2c1NC(=O)C(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H24N2O4S/c1-3-18-14-23(18,2)22(27)25-30(28,29)19-11-7-10-16-13-17(21(26)24-20(16)19)12-15-8-5-4-6-9-15/h3-11,17-18H,1,12-14H2,2H3,(H,24,26)(H,25,27)/t17?,18-,23+/m1/s1 |
| InChIKey | HFXANMCHTGQPOT-GTGLXDFNSA-N |
| XLogP | 3.06 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|