C22H23NO4S — CID 59665765
cis-(1S,2S)-2-ethenyl-1-methyl-N-[(2-phenyl-3,4-dihydro-2H-chromen-7-yl)sulfonyl]cyclopropane-1-carboxamide (PubChem CID 59665765) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is cis-(1S,2S)-2-ethenyl-1-methyl-N-[(2-phenyl-3,4-dihydro-2H-chromen-7-yl)sulfonyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-2-ethenyl-1-methyl-N-[(2-phenyl-3,4-dihydro-2H-chromen-7-yl)sulfonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59665765 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | cis-(1S,2S)-2-ethenyl-1-methyl-N-[(2-phenyl-3,4-dihydro-2H-chromen-7-yl)sulfonyl]cyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1ccc2c(c1)OC(c1ccccc1)CC2 |
| InChI | InChI=1S/C22H23NO4S/c1-3-17-14-22(17,2)21(24)23-28(25,26)18-11-9-16-10-12-19(27-20(16)13-18)15-7-5-4-6-8-15/h3-9,11,13,17,19H,1,10,12,14H2,2H3,(H,23,24)/t17-,19?,22+/m1/s1 |
| InChIKey | LAOAGYZGYUBIBE-KKGGMLHBSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|