About N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide
N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide (PubChem CID 59665896) has the molecular formula C19H19N3O4S
and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide.
Molecular Properties
| Compound Name | N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide |
| PubChem CID | 59665896 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide |
| SMILES | C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1cccnc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-3-14-12-19(14,2)18(24)22-27(25,26)15-10-7-11-20-16(15)21-17(23)13-8-5-4-6-9-13/h3-11,14H,1,12H2,2H3,(H,22,24)(H,20,21,23)/t14-,19+/m1/s1 |
| InChIKey | IQSPCXLBAATIMX-KUHUBIRLSA-N |
| XLogP | 2.35 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide?
The IUPAC name of N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide (CID 59665896) is N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide.
What is the SMILES notation for N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide?
The canonical SMILES for N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide is C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1cccnc1NC(=O)c1ccccc1.
What is the InChIKey of N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide?
The InChIKey is IQSPCXLBAATIMX-KUHUBIRLSA-N. The full InChI is InChI=1S/C19H19N3O4S/c1-3-14-12-19(14,2)18(24)22-27(25,26)15-10-7-11-20-16(15)21-17(23)13-8-5-4-6-9-13/h3-11,14H,1,12H2,2H3,(H,22,24)(H,20,21,23)/t14-,19+/m1/s1.
What are the key properties of N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide?
N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide has a molecular weight of 385.45 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]-2-pyridinyl]benzamide is sourced from PubChem (CID 59665896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).