C14H22O2 — CID 59666328
(2,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl) acetate (PubChem CID 59666328) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl) acetate.
| Compound Name | (2,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 59666328 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl) acetate |
| SMILES | CC(=O)OC1C2=CCCC(C)C2CCC1C |
| InChI | InChI=1S/C14H22O2/c1-9-5-4-6-13-12(9)8-7-10(2)14(13)16-11(3)15/h6,9-10,12,14H,4-5,7-8H2,1-3H3 |
| InChIKey | ALRWFUGWLRINJC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|