C18H21NO4 — CID 59666388
(4R,4aS,12bS)-6,6,7a-trideuterio-4a-hydroxy-9-methoxy-3-methyl-2,4,5,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 59666388) has the molecular formula C18H21NO4 and a molecular weight of 318.39 g/mol. Its IUPAC name is (4R,4aS,12bS)-6,6,7a-trideuterio-4a-hydroxy-9-methoxy-3-methyl-2,4,5,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,12bS)-6,6,7a-trideuterio-4a-hydroxy-9-methoxy-3-methyl-2,4,5,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 59666388 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (4R,4aS,12bS)-6,6,7a-trideuterio-4a-hydroxy-9-methoxy-3-methyl-2,4,5,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | [2H]C1([2H])C[C@@]2(O)[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)C([2H])(O5)C1=O |
| InChI | InChI=1S/C18H21NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,13,16,21H,5-9H2,1-2H3/t13-,16?,17+,18-/m1/s1/i5D2,16D |
| InChIKey | BRUQQQPBMZOVGD-DQRWXCFUSA-N |
| XLogP | 1.05 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |