C18H21NO3 — CID 59666519
(4R,4aR,12bS)-4a,10,11,13,13-pentadeuterio-3-methyl-9-(trideuteriomethoxy)-1,2,4,5,6,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 59666519) has the molecular formula C18H21NO3 and a molecular weight of 307.42 g/mol. Its IUPAC name is (4R,4aR,12bS)-4a,10,11,13,13-pentadeuterio-3-methyl-9-(trideuteriomethoxy)-1,2,4,5,6,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aR,12bS)-4a,10,11,13,13-pentadeuterio-3-methyl-9-(trideuteriomethoxy)-1,2,4,5,6,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 59666519 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (4R,4aR,12bS)-4a,10,11,13,13-pentadeuterio-3-methyl-9-(trideuteriomethoxy)-1,2,4,5,6,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | [2H]c1c([2H])c2c3c(c1OC([2H])([2H])[2H])OC1C(=O)CC[C@@]4([2H])[C@H](N(C)CC[C@]314)C2([2H])[2H] |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-12,17H,4-5,7-9H2,1-2H3/t11-,12+,17?,18-/m0/s1/i2D3,3D,6D,9D2,11D |
| InChIKey | LLPOLZWFYMWNKH-OOLWDETCSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |