C18H21NO3 — CID 59666658
(4R,4aR,12bS)-4a,10,11-trideuterio-7-deuteriooxy-3-methyl-9-(trideuteriomethoxy)-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 59666658) has the molecular formula C18H21NO3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (4R,4aR,12bS)-4a,10,11-trideuterio-7-deuteriooxy-3-methyl-9-(trideuteriomethoxy)-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,4aR,12bS)-4a,10,11-trideuterio-7-deuteriooxy-3-methyl-9-(trideuteriomethoxy)-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 59666658 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (4R,4aR,12bS)-4a,10,11-trideuterio-7-deuteriooxy-3-methyl-9-(trideuteriomethoxy)-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | [2H]OC1C=C[C@@]2([2H])[C@H]3Cc4c([2H])c([2H])c(OC([2H])([2H])[2H])c5c4[C@@]2(CCN3C)C1O5 |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-6,11-13,17,20H,7-9H2,1-2H3/t11-,12+,13?,17?,18-/m0/s1/i2D3,3D,6D,11D,20D |
| InChIKey | OROGSEYTTFOCAN-ARBTXXTKSA-N |
| XLogP | 1.50 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|