C15H23N3OS — CID 59667546
2-[4-(4,4-dimethylpentoxy)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-amine (PubChem CID 59667546) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpentoxy)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-amine.
| Compound Name | 2-[4-(4,4-dimethylpentoxy)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 59667546 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[4-(4,4-dimethylpentoxy)phenyl]-2,3-dihydro-1,3,4-thiadiazol-5-amine |
| SMILES | CC(C)(C)CCCOc1ccc(C2NN=C(N)S2)cc1 |
| InChI | InChI=1S/C15H23N3OS/c1-15(2,3)9-4-10-19-12-7-5-11(6-8-12)13-17-18-14(16)20-13/h5-8,13,17H,4,9-10H2,1-3H3,(H2,16,18) |
| InChIKey | QHZHXINFEIUJPV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|