About (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol
(1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol (PubChem CID 59667807) has the molecular formula C14H21FO3S
and a molecular weight of 288.38 g/mol. Its IUPAC name is (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol.
Molecular Properties
| Compound Name | (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol |
| PubChem CID | 59667807 |
| Molecular Formula | C14H21FO3S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol |
| SMILES | CC(C)(C)[C@@H](CF)[C@H](O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21FO3S/c1-14(2,3)12(9-15)13(16)10-5-7-11(8-6-10)19(4,17)18/h5-8,12-13,16H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | QFMBECGKTKBJJC-QWHCGFSZSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol?
The IUPAC name of (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol (CID 59667807) is (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol.
What is the SMILES notation for (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol?
The canonical SMILES for (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol is CC(C)(C)[C@@H](CF)[C@H](O)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol?
The InChIKey is QFMBECGKTKBJJC-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H21FO3S/c1-14(2,3)12(9-15)13(16)10-5-7-11(8-6-10)19(4,17)18/h5-8,12-13,16H,9H2,1-4H3/t12-,13+/m0/s1.
What are the key properties of (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol?
(1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol has a molecular weight of 288.38 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-(fluoromethyl)-3,3-dimethyl-1-(4-methylsulfonylphenyl)butan-1-ol is sourced from PubChem (CID 59667807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).