C18H25NO — CID 59668618
(2R,3R,11bR)-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] (PubChem CID 59668618) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (2R,3R,11bR)-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane].
| Compound Name | (2R,3R,11bR)-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
|---|---|
| PubChem CID | 59668618 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2R,3R,11bR)-3-(2-methylpropyl)spiro[1,3,4,6,7,11b-hexahydrobenzo[a]quinolizine-2,2'-oxirane] |
| SMILES | CC(C)C[C@@H]1CN2CCc3ccccc3[C@H]2C[C@]12CO2 |
| InChI | InChI=1S/C18H25NO/c1-13(2)9-15-11-19-8-7-14-5-3-4-6-16(14)17(19)10-18(15)12-20-18/h3-6,13,15,17H,7-12H2,1-2H3/t15-,17-,18+/m1/s1 |
| InChIKey | OTAZOZLISWLJCE-NXHRZFHOSA-N |
| XLogP | 3.42 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|