About 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one
1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one (PubChem CID 59668715) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one |
| PubChem CID | 59668715 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C8H14FNO/c1-5(2)8(11)7-3-6(9)4-10-7/h5-7,10H,3-4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | UPLMCZGJFSQPMX-BQBZGAKWSA-N |
| XLogP | 0.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one (CID 59668715) is 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one is CC(C)C(=O)[C@@H]1C[C@H](F)CN1.
What is the InChIKey of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The InChIKey is UPLMCZGJFSQPMX-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H14FNO/c1-5(2)8(11)7-3-6(9)4-10-7/h5-7,10H,3-4H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one?
1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one has a molecular weight of 159.20 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-methylpropan-1-one is sourced from PubChem (CID 59668715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).