About 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one
1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one (PubChem CID 59668915) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one |
| PubChem CID | 59668915 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)[C@@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C8H13F2NO/c1-5(2)7(12)6-3-8(9,10)4-11-6/h5-6,11H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | CDSBGGCDCYNYBJ-LURJTMIESA-N |
| XLogP | 1.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one (CID 59668915) is 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one is CC(C)C(=O)[C@@H]1CC(F)(F)CN1.
What is the InChIKey of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one?
The InChIKey is CDSBGGCDCYNYBJ-LURJTMIESA-N. The full InChI is InChI=1S/C8H13F2NO/c1-5(2)7(12)6-3-8(9,10)4-11-6/h5-6,11H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one?
1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one has a molecular weight of 177.19 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4,4-difluoropyrrolidin-2-yl]-2-methylpropan-1-one is sourced from PubChem (CID 59668915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).