About (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one
(4R)-4-(diethylamino)-2,2-dimethylhexan-3-one (PubChem CID 59668998) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one.
Molecular Properties
| Compound Name | (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one |
| PubChem CID | 59668998 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one |
| SMILES | CC[C@H](C(=O)C(C)(C)C)N(CC)CC |
| InChI | InChI=1S/C12H25NO/c1-7-10(13(8-2)9-3)11(14)12(4,5)6/h10H,7-9H2,1-6H3/t10-/m1/s1 |
| InChIKey | IYPQBHYUMJMBCZ-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one?
The IUPAC name of (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one (CID 59668998) is (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one.
What is the SMILES notation for (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one?
The canonical SMILES for (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one is CC[C@H](C(=O)C(C)(C)C)N(CC)CC.
What is the InChIKey of (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one?
The InChIKey is IYPQBHYUMJMBCZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H25NO/c1-7-10(13(8-2)9-3)11(14)12(4,5)6/h10H,7-9H2,1-6H3/t10-/m1/s1.
What are the key properties of (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one?
(4R)-4-(diethylamino)-2,2-dimethylhexan-3-one has a molecular weight of 199.34 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(diethylamino)-2,2-dimethylhexan-3-one is sourced from PubChem (CID 59668998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).