C16H10F20O2 — CID 59669335
1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)-2-[2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)oxyethoxy]pent-2-ene (PubChem CID 59669335) has the molecular formula C16H10F20O2 and a molecular weight of 614.21 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)-2-[2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)oxyethoxy]pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)-2-[2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)oxyethoxy]pent-2-ene |
|---|---|
| PubChem CID | 59669335 |
| Molecular Formula | C16H10F20O2 |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 614.04 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethyl)-2-[2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)oxyethoxy]pent-2-ene |
| SMILES | CC(C)=C(OCCOC(=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H10F20O2/c1-5(2)7(11(19,20)21)37-3-4-38-8(12(22,23)24)6(9(17,13(25,26)27)14(28,29)30)10(18,15(31,32)33)16(34,35)36/h3-4H2,1-2H3 |
| InChIKey | FFQVQZLUECFUMH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|