C21H30N4O6S2 — CID 59669363
(1S,7Z,10S,16E,21R)-7-ethylidene-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 59669363) has the molecular formula C21H30N4O6S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is (1S,7Z,10S,16E,21R)-7-ethylidene-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (1S,7Z,10S,16E,21R)-7-ethylidene-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 59669363 |
| Molecular Formula | C21H30N4O6S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (1S,7Z,10S,16E,21R)-7-ethylidene-21-propan-2-yl-2-oxa-12,13-dithia-5,8,20,23-tetrazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | C/C=C1\NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)CNC1=O |
| InChI | InChI=1S/C21H30N4O6S2/c1-4-14-19(28)22-10-17(27)31-13-7-5-6-8-32-33-11-15(20(29)23-14)24-21(30)18(12(2)3)25-16(26)9-13/h4-5,7,12-13,15,18H,6,8-11H2,1-3H3,(H,22,28)(H,23,29)(H,24,30)(H,25,26)/b7-5+,14-4-/t13-,15-,18-/m1/s1 |
| InChIKey | MFWNOZKIKREYBG-WXWWPAJNSA-N |
| XLogP | 0.41 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|