C10H11OY- — CID 59669840
2-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium (PubChem CID 59669840) has the molecular formula C10H11OY- and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium.
| Compound Name | 2-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium |
|---|---|
| PubChem CID | 59669840 |
| Molecular Formula | C10H11OY- |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-methyl-2,3,4,8-tetrahydrochromen-8-ide;yttrium |
| SMILES | CC1CCc2ccc[c-]c2O1.[Y] |
| InChI | InChI=1S/C10H11O.Y/c1-8-6-7-9-4-2-3-5-10(9)11-8;/h2-4,8H,6-7H2,1H3;/q-1; |
| InChIKey | OHPGJQMKCMYBCT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|