C22H30N6O2 — CID 59670080
[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone (PubChem CID 59670080) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 59670080 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1noc(C)c1C(=O)N1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C22H30N6O2/c1-15-20(16(2)30-25-15)21(29)27-8-6-17-14-23-22(24-19(17)7-9-27)28-12-10-26(11-13-28)18-4-3-5-18/h14,18H,3-13H2,1-2H3 |
| InChIKey | MKWLPUJPYKMHMV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |