C14H20ClNO — CID 59670752
6-amino-4-(4-chlorophenyl)-2,4-dimethylhexan-3-one (PubChem CID 59670752) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 6-amino-4-(4-chlorophenyl)-2,4-dimethylhexan-3-one.
| Compound Name | 6-amino-4-(4-chlorophenyl)-2,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 59670752 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-amino-4-(4-chlorophenyl)-2,4-dimethylhexan-3-one |
| SMILES | CC(C)C(=O)C(C)(CCN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO/c1-10(2)13(17)14(3,8-9-16)11-4-6-12(15)7-5-11/h4-7,10H,8-9,16H2,1-3H3 |
| InChIKey | BIEGKMIHRQBEGD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |