About (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine
(5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 59670769) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
Molecular Properties
| Compound Name | (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| PubChem CID | 59670769 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | C[C@@H]1CCc2ncnc(Cl)c21 |
| InChI | InChI=1S/C8H9ClN2/c1-5-2-3-6-7(5)8(9)11-4-10-6/h4-5H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | AUMBWDKTDZHUNN-RXMQYKEDSA-N |
| XLogP | 2.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The IUPAC name of (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CID 59670769) is (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
What is the SMILES notation for (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The canonical SMILES for (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is C[C@@H]1CCc2ncnc(Cl)c21.
What is the InChIKey of (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The InChIKey is AUMBWDKTDZHUNN-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H9ClN2/c1-5-2-3-6-7(5)8(9)11-4-10-6/h4-5H,2-3H2,1H3/t5-/m1/s1.
What are the key properties of (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
(5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine has a molecular weight of 168.63 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-chloro-5-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is sourced from PubChem (CID 59670769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).