C15H22FNO — CID 59670824
1-(ethylamino)-2-(4-fluorophenyl)-4,4-dimethylpentan-3-one (PubChem CID 59670824) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 1-(ethylamino)-2-(4-fluorophenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(ethylamino)-2-(4-fluorophenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 59670824 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-(ethylamino)-2-(4-fluorophenyl)-4,4-dimethylpentan-3-one |
| SMILES | CCNCC(C(=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNO/c1-5-17-10-13(14(18)15(2,3)4)11-6-8-12(16)9-7-11/h6-9,13,17H,5,10H2,1-4H3 |
| InChIKey | CPHOAQHPHPLYIC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |