C16H31NO6Si — CID 59671234
methyl N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]carbamate (PubChem CID 59671234) has the molecular formula C16H31NO6Si and a molecular weight of 361.51 g/mol. Its IUPAC name is methyl N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]carbamate.
| Compound Name | methyl N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]carbamate |
|---|---|
| PubChem CID | 59671234 |
| Molecular Formula | C16H31NO6Si |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]carbamate |
| SMILES | COC(=O)N[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H31NO6Si/c1-15(2,3)24(7,8)20-9-10-11-12(23-16(4,5)22-11)13(21-10)17-14(18)19-6/h10-13H,9H2,1-8H3,(H,17,18)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | HQXONCREOKYOQI-FDYHWXHSSA-N |
| XLogP | 2.61 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|