C10H15ClN4O3 — CID 59671237
(1R,2S,3R,5R)-3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 59671237) has the molecular formula C10H15ClN4O3 and a molecular weight of 274.71 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 59671237 |
| Molecular Formula | C10H15ClN4O3 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(Cl)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C10H15ClN4O3/c1-4-12-9(11)15-10(13-4)14-6-2-5(3-16)7(17)8(6)18/h5-8,16-18H,2-3H2,1H3,(H,12,13,14,15)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | QITAVLYFPCRTEP-XUTVFYLZSA-N |
| XLogP | -0.65 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |