C13H18ClN3O3 — CID 59671267
[(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 59671267) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 59671267 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-[(6-chloropyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO)C[C@@H](Nc3cc(Cl)ncn3)[C@@H]2O1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-13(2)19-11-7(5-18)3-8(12(11)20-13)17-10-4-9(14)15-6-16-10/h4,6-8,11-12,18H,3,5H2,1-2H3,(H,15,16,17)/t7-,8-,11-,12+/m1/s1 |
| InChIKey | HVPNEMQIIFTTPT-VNOQCFOKSA-N |
| XLogP | 1.44 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |