About N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide (PubChem CID 59671543) has the molecular formula C18H18FN5O2S
and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide |
| PubChem CID | 59671543 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)N1CCNCC1COc1cccnc1 |
| InChI | InChI=1S/C18H18FN5O2S/c19-12-3-4-15-16(8-12)27-17(22-15)23-18(25)24-7-6-21-9-13(24)11-26-14-2-1-5-20-10-14/h1-5,8,10,13,21H,6-7,9,11H2,(H,22,23,25) |
| InChIKey | CVLREYLUGCQNTF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide?
The IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide (CID 59671543) is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide.
What is the SMILES notation for N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide?
The canonical SMILES for N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide is O=C(Nc1nc2ccc(F)cc2s1)N1CCNCC1COc1cccnc1.
What is the InChIKey of N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide?
The InChIKey is CVLREYLUGCQNTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN5O2S/c19-12-3-4-15-16(8-12)27-17(22-15)23-18(25)24-7-6-21-9-13(24)11-26-14-2-1-5-20-10-14/h1-5,8,10,13,21H,6-7,9,11H2,(H,22,23,25).
What are the key properties of N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide?
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide has a molecular weight of 387.44 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(pyridin-3-yloxymethyl)piperazine-1-carboxamide is sourced from PubChem (CID 59671543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).