About 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone
1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone (PubChem CID 59671573) has the molecular formula C20H22N4O3S
and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone |
| PubChem CID | 59671573 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc2nc(N3CCN(C(C)=O)CC3COc3cccnc3)sc2c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-14(25)23-8-9-24(15(12-23)13-27-17-4-3-7-21-11-17)20-22-18-6-5-16(26-2)10-19(18)28-20/h3-7,10-11,15H,8-9,12-13H2,1-2H3 |
| InChIKey | XHZRFPKYJVGJFX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone (CID 59671573) is 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone is COc1ccc2nc(N3CCN(C(C)=O)CC3COc3cccnc3)sc2c1.
What is the InChIKey of 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone?
The InChIKey is XHZRFPKYJVGJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3S/c1-14(25)23-8-9-24(15(12-23)13-27-17-4-3-7-21-11-17)20-22-18-6-5-16(26-2)10-19(18)28-20/h3-7,10-11,15H,8-9,12-13H2,1-2H3.
What are the key properties of 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone?
1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone has a molecular weight of 398.49 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(pyridin-3-yloxymethyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 59671573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).