About 2-tert-butyl-5-(2,4-dichlorophenyl)furan
2-tert-butyl-5-(2,4-dichlorophenyl)furan (PubChem CID 59671598) has the molecular formula C14H14Cl2O
and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,4-dichlorophenyl)furan.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2,4-dichlorophenyl)furan |
| PubChem CID | 59671598 |
| Molecular Formula | C14H14Cl2O |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-tert-butyl-5-(2,4-dichlorophenyl)furan |
| SMILES | CC(C)(C)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C14H14Cl2O/c1-14(2,3)13-7-6-12(17-13)10-5-4-9(15)8-11(10)16/h4-8H,1-3H3 |
| InChIKey | UWMNPJHAAZGJFI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-5-(2,4-dichlorophenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2,4-dichlorophenyl)furan?
The IUPAC name of 2-tert-butyl-5-(2,4-dichlorophenyl)furan (CID 59671598) is 2-tert-butyl-5-(2,4-dichlorophenyl)furan.
What is the SMILES notation for 2-tert-butyl-5-(2,4-dichlorophenyl)furan?
The canonical SMILES for 2-tert-butyl-5-(2,4-dichlorophenyl)furan is CC(C)(C)c1ccc(-c2ccc(Cl)cc2Cl)o1.
What is the InChIKey of 2-tert-butyl-5-(2,4-dichlorophenyl)furan?
The InChIKey is UWMNPJHAAZGJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2O/c1-14(2,3)13-7-6-12(17-13)10-5-4-9(15)8-11(10)16/h4-8H,1-3H3.
What are the key properties of 2-tert-butyl-5-(2,4-dichlorophenyl)furan?
2-tert-butyl-5-(2,4-dichlorophenyl)furan has a molecular weight of 269.17 g/mol, XLogP of 5.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2,4-dichlorophenyl)furan is sourced from PubChem (CID 59671598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).