C24H44O3S — CID 59671928
2-(furan-2-ylsulfanyl)-3,7,11,15-tetramethylhexadecane-1,3-diol (PubChem CID 59671928) has the molecular formula C24H44O3S and a molecular weight of 412.68 g/mol. Its IUPAC name is 2-(furan-2-ylsulfanyl)-3,7,11,15-tetramethylhexadecane-1,3-diol.
| Compound Name | 2-(furan-2-ylsulfanyl)-3,7,11,15-tetramethylhexadecane-1,3-diol |
|---|---|
| PubChem CID | 59671928 |
| Molecular Formula | C24H44O3S |
| Molecular Weight | 412.68 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 2-(furan-2-ylsulfanyl)-3,7,11,15-tetramethylhexadecane-1,3-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)(O)C(CO)Sc1ccco1 |
| InChI | InChI=1S/C24H44O3S/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-16-24(5,26)22(18-25)28-23-15-9-17-27-23/h9,15,17,19-22,25-26H,6-8,10-14,16,18H2,1-5H3 |
| InChIKey | VKPDKFRWNFCAQA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.68 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |