C25H44S — CID 59671943
5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylcyclopenta-1,3-diene (PubChem CID 59671943) has the molecular formula C25H44S and a molecular weight of 376.69 g/mol. Its IUPAC name is 5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylcyclopenta-1,3-diene.
| Compound Name | 5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 59671943 |
| Molecular Formula | C25H44S |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 5-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylcyclopenta-1,3-diene |
| SMILES | C/C(=C\CSC1C=CC=C1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C25H44S/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-20-26-25-17-6-7-18-25/h6-7,17-19,21-23,25H,8-16,20H2,1-5H3/b24-19+ |
| InChIKey | MUZHAMXAFDBOJD-LYBHJNIJSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|