C22H46O2S — CID 59671971
2-ethylsulfanyl-3,7,11,15-tetramethylhexadecane-1,3-diol (PubChem CID 59671971) has the molecular formula C22H46O2S and a molecular weight of 374.68 g/mol. Its IUPAC name is 2-ethylsulfanyl-3,7,11,15-tetramethylhexadecane-1,3-diol.
| Compound Name | 2-ethylsulfanyl-3,7,11,15-tetramethylhexadecane-1,3-diol |
|---|---|
| PubChem CID | 59671971 |
| Molecular Formula | C22H46O2S |
| Molecular Weight | 374.68 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 2-ethylsulfanyl-3,7,11,15-tetramethylhexadecane-1,3-diol |
| SMILES | CCSC(CO)C(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H46O2S/c1-7-25-21(17-23)22(6,24)16-10-15-20(5)14-9-13-19(4)12-8-11-18(2)3/h18-21,23-24H,7-17H2,1-6H3 |
| InChIKey | NTOBHPPNQNYXGQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |