C51H80O7 — CID 59672007
tris[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 59672007) has the molecular formula C51H80O7 and a molecular weight of 805.19 g/mol. Its IUPAC name is tris[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 59672007 |
| Molecular Formula | C51H80O7 |
| Molecular Weight | 805.19 g/mol |
| Exact Mass | 804.59 |
| IUPAC Name | tris[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=O)CC(O)(CC(=O)OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)OC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C51H80O7/c1-39(2)19-13-22-42(7)25-16-28-45(10)31-34-56-48(52)37-51(55,50(54)58-36-33-47(12)30-18-27-44(9)24-15-21-41(5)6)38-49(53)57-35-32-46(11)29-17-26-43(8)23-14-20-40(3)4/h19-21,25-27,31-33,55H,13-18,22-24,28-30,34-38H2,1-12H3/b42-25+,43-26+,44-27+,45-31+,46-32+,47-33+ |
| InChIKey | UTCPLNYPUTYWKA-RMZAWNBSSA-N |
| XLogP | 13.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.19 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|