C22H42O2 — CID 59672090
2,2,3,3,4-pentamethyl-4-[6-(2,3,3,4,4-pentamethyloxetan-2-yl)hexyl]oxetane (PubChem CID 59672090) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 2,2,3,3,4-pentamethyl-4-[6-(2,3,3,4,4-pentamethyloxetan-2-yl)hexyl]oxetane.
| Compound Name | 2,2,3,3,4-pentamethyl-4-[6-(2,3,3,4,4-pentamethyloxetan-2-yl)hexyl]oxetane |
|---|---|
| PubChem CID | 59672090 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 2,2,3,3,4-pentamethyl-4-[6-(2,3,3,4,4-pentamethyloxetan-2-yl)hexyl]oxetane |
| SMILES | CC1(C)OC(C)(CCCCCCC2(C)OC(C)(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C22H42O2/c1-17(2)19(5,6)23-21(17,9)15-13-11-12-14-16-22(10)18(3,4)20(7,8)24-22/h11-16H2,1-10H3 |
| InChIKey | UHFOANDEJGUPKM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|