About CID 59672178
CID 59672178 (PubChem CID 59672178) has the molecular formula C7H12NO2
and a molecular weight of 142.18 g/mol.
Molecular Properties
| Compound Name | CID 59672178 |
| PubChem CID | 59672178 |
| Molecular Formula | C7H12NO2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | — |
| SMILES | CC(=O)CCC([NH])C(C)=O |
| InChI | InChI=1S/C7H12NO2/c1-5(9)3-4-7(8)6(2)10/h7-8H,3-4H2,1-2H3 |
| InChIKey | GGZBWGLHIXNBNV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59672178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59672178?
The IUPAC name of CID 59672178 (CID 59672178) is not available.
What is the SMILES notation for CID 59672178?
The canonical SMILES for CID 59672178 is CC(=O)CCC([NH])C(C)=O.
What is the InChIKey of CID 59672178?
The InChIKey is GGZBWGLHIXNBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12NO2/c1-5(9)3-4-7(8)6(2)10/h7-8H,3-4H2,1-2H3.
What are the key properties of CID 59672178?
CID 59672178 has a molecular weight of 142.18 g/mol, XLogP of 0.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59672178 is sourced from PubChem (CID 59672178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).