C31H27F3N2O2S — CID 59672303
5-benzo[e][1,3]benzothiazol-2-yl-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 59672303) has the molecular formula C31H27F3N2O2S and a molecular weight of 548.63 g/mol. Its IUPAC name is 5-benzo[e][1,3]benzothiazol-2-yl-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-benzo[e][1,3]benzothiazol-2-yl-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 59672303 |
| Molecular Formula | C31H27F3N2O2S |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 5-benzo[e][1,3]benzothiazol-2-yl-10,10,16,16-tetramethyl-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1c(C(F)(F)F)c(-c2nc4c(ccc5ccccc54)s2)c(=O)oc31 |
| InChI | InChI=1S/C31H27F3N2O2S/c1-29(2)11-13-36-14-12-30(3,4)23-25(36)19(29)15-18-22(31(32,33)34)21(28(37)38-26(18)23)27-35-24-17-8-6-5-7-16(17)9-10-20(24)39-27/h5-10,15H,11-14H2,1-4H3 |
| InChIKey | VETFDOZTMXPONL-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|