C33H29F3N2O2S — CID 59672304
10,10,16,16-tetramethyl-5-(5-phenyl-1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 59672304) has the molecular formula C33H29F3N2O2S and a molecular weight of 574.67 g/mol. Its IUPAC name is 10,10,16,16-tetramethyl-5-(5-phenyl-1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 10,10,16,16-tetramethyl-5-(5-phenyl-1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 59672304 |
| Molecular Formula | C33H29F3N2O2S |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 10,10,16,16-tetramethyl-5-(5-phenyl-1,3-benzothiazol-2-yl)-6-(trifluoromethyl)-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1c(C(F)(F)F)c(-c2nc4cc(-c5ccccc5)ccc4s2)c(=O)oc31 |
| InChI | InChI=1S/C33H29F3N2O2S/c1-31(2)12-14-38-15-13-32(3,4)26-27(38)21(31)17-20-25(33(34,35)36)24(30(39)40-28(20)26)29-37-22-16-19(10-11-23(22)41-29)18-8-6-5-7-9-18/h5-11,16-17H,12-15H2,1-4H3 |
| InChIKey | NUSAPJXQAFGIFD-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|