C8H10F6NO5S2- — CID 59672420
1-(1,1,2,2,3,3-hexafluoro-3-oxidoperoxysulfanylpropyl)sulfonylpiperidine (PubChem CID 59672420) has the molecular formula C8H10F6NO5S2- and a molecular weight of 378.29 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoro-3-oxidoperoxysulfanylpropyl)sulfonylpiperidine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoro-3-oxidoperoxysulfanylpropyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 59672420 |
| Molecular Formula | C8H10F6NO5S2- |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoro-3-oxidoperoxysulfanylpropyl)sulfonylpiperidine |
| SMILES | O=S(=O)(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C8H11F6NO5S2/c9-6(10,7(11,12)21-20-19-16)8(13,14)22(17,18)15-4-2-1-3-5-15/h16H,1-5H2/p-1 |
| InChIKey | YBKSESJMQIQYQG-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|