About (2-oxo-1-pyridinyl) propan-2-yl carbonate
(2-oxo-1-pyridinyl) propan-2-yl carbonate (PubChem CID 59672521) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is (2-oxo-1-pyridinyl) propan-2-yl carbonate.
Molecular Properties
| Compound Name | (2-oxo-1-pyridinyl) propan-2-yl carbonate |
| PubChem CID | 59672521 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (2-oxo-1-pyridinyl) propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)On1ccccc1=O |
| InChI | InChI=1S/C9H11NO4/c1-7(2)13-9(12)14-10-6-4-3-5-8(10)11/h3-7H,1-2H3 |
| InChIKey | MROZSZGPHXHFBV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxo-1-pyridinyl) propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-pyridinyl) propan-2-yl carbonate?
The IUPAC name of (2-oxo-1-pyridinyl) propan-2-yl carbonate (CID 59672521) is (2-oxo-1-pyridinyl) propan-2-yl carbonate.
What is the SMILES notation for (2-oxo-1-pyridinyl) propan-2-yl carbonate?
The canonical SMILES for (2-oxo-1-pyridinyl) propan-2-yl carbonate is CC(C)OC(=O)On1ccccc1=O.
What is the InChIKey of (2-oxo-1-pyridinyl) propan-2-yl carbonate?
The InChIKey is MROZSZGPHXHFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-7(2)13-9(12)14-10-6-4-3-5-8(10)11/h3-7H,1-2H3.
What are the key properties of (2-oxo-1-pyridinyl) propan-2-yl carbonate?
(2-oxo-1-pyridinyl) propan-2-yl carbonate has a molecular weight of 197.19 g/mol, XLogP of 0.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-pyridinyl) propan-2-yl carbonate is sourced from PubChem (CID 59672521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).