C29H31N3O2 — CID 59674299
N,N-diethyl-4-(6-pyridin-3-ylspiro[chromene-2,4'-piperidine]-4-yl)benzamide (PubChem CID 59674299) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N,N-diethyl-4-(6-pyridin-3-ylspiro[chromene-2,4'-piperidine]-4-yl)benzamide.
| Compound Name | N,N-diethyl-4-(6-pyridin-3-ylspiro[chromene-2,4'-piperidine]-4-yl)benzamide |
|---|---|
| PubChem CID | 59674299 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | N,N-diethyl-4-(6-pyridin-3-ylspiro[chromene-2,4'-piperidine]-4-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2=CC3(CCNCC3)Oc3ccc(-c4cccnc4)cc32)cc1 |
| InChI | InChI=1S/C29H31N3O2/c1-3-32(4-2)28(33)22-9-7-21(8-10-22)26-19-29(13-16-30-17-14-29)34-27-12-11-23(18-25(26)27)24-6-5-15-31-20-24/h5-12,15,18-20,30H,3-4,13-14,16-17H2,1-2H3 |
| InChIKey | KPTIABQGTXGDLJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |