About 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile
3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile (PubChem CID 59674314) has the molecular formula C20H18N2O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile.
Molecular Properties
| Compound Name | 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile |
| PubChem CID | 59674314 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile |
| SMILES | N#Cc1cccc(C2=CC3(CCNCC3)Oc3ccccc32)c1 |
| InChI | InChI=1S/C20H18N2O/c21-14-15-4-3-5-16(12-15)18-13-20(8-10-22-11-9-20)23-19-7-2-1-6-17(18)19/h1-7,12-13,22H,8-11H2 |
| InChIKey | JKAWXVKFUDJLPT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile?
The IUPAC name of 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile (CID 59674314) is 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile.
What is the SMILES notation for 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile?
The canonical SMILES for 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile is N#Cc1cccc(C2=CC3(CCNCC3)Oc3ccccc32)c1.
What is the InChIKey of 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile?
The InChIKey is JKAWXVKFUDJLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O/c21-14-15-4-3-5-16(12-15)18-13-20(8-10-22-11-9-20)23-19-7-2-1-6-17(18)19/h1-7,12-13,22H,8-11H2.
What are the key properties of 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile?
3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile has a molecular weight of 302.38 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-spiro[chromene-2,4'-piperidine]-4-ylbenzonitrile is sourced from PubChem (CID 59674314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).