C23H26N2O2 — CID 59674350
2-methyl-N-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)propanamide (PubChem CID 59674350) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methyl-N-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)propanamide.
| Compound Name | 2-methyl-N-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 59674350 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-methyl-N-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C2=CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-16(2)22(26)25-18-9-7-17(8-10-18)20-15-23(11-13-24-14-12-23)27-21-6-4-3-5-19(20)21/h3-10,15-16,24H,11-14H2,1-2H3,(H,25,26) |
| InChIKey | PGLZSWYLNAASAN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |