About tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate
tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 59674488) has the molecular formula C25H26N2O3
and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 59674488 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C=C(c3ccc(C#N)cc3)c3ccccc3O2)CC1 |
| InChI | InChI=1S/C25H26N2O3/c1-24(2,3)30-23(28)27-14-12-25(13-15-27)16-21(19-10-8-18(17-26)9-11-19)20-6-4-5-7-22(20)29-25/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | LEOSPMJTYIRDLK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate (CID 59674488) is tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate is CC(C)(C)OC(=O)N1CCC2(C=C(c3ccc(C#N)cc3)c3ccccc3O2)CC1.
What is the InChIKey of tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate?
The InChIKey is LEOSPMJTYIRDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O3/c1-24(2,3)30-23(28)27-14-12-25(13-15-27)16-21(19-10-8-18(17-26)9-11-19)20-6-4-5-7-22(20)29-25/h4-11,16H,12-15H2,1-3H3.
What are the key properties of tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate?
tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate has a molecular weight of 402.49 g/mol, XLogP of 5.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(4-cyanophenyl)spiro[chromene-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 59674488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).