About methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate
methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate (PubChem CID 59674678) has the molecular formula C24H25N5O3
and a molecular weight of 431.50 g/mol. Its IUPAC name is methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate |
| PubChem CID | 59674678 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate |
| SMILES | COC(=O)CCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C24H25N5O3/c1-31-22(30)10-15-29-27-23(26-28-29)18-8-6-17(7-9-18)20-16-24(11-13-25-14-12-24)32-21-5-3-2-4-19(20)21/h2-9,16,25H,10-15H2,1H3 |
| InChIKey | ZTOBULTXMUMIGN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate?
The IUPAC name of methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate (CID 59674678) is methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate.
What is the SMILES notation for methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate?
The canonical SMILES for methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate is COC(=O)CCn1nnc(-c2ccc(C3=CC4(CCNCC4)Oc4ccccc43)cc2)n1.
What is the InChIKey of methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate?
The InChIKey is ZTOBULTXMUMIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5O3/c1-31-22(30)10-15-29-27-23(26-28-29)18-8-6-17(7-9-18)20-16-24(11-13-25-14-12-24)32-21-5-3-2-4-19(20)21/h2-9,16,25H,10-15H2,1H3.
What are the key properties of methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate?
methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate has a molecular weight of 431.50 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-(4-spiro[chromene-2,4'-piperidine]-4-ylphenyl)tetrazol-2-yl]propanoate is sourced from PubChem (CID 59674678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).