About 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine
4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine (PubChem CID 59675555) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine |
| PubChem CID | 59675555 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine |
| SMILES | CCOC1=NS(=O)N=C1N[C@H](CC)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-11(10-8-6-5-7-9-10)14-12-13(18-4-2)16-19(17)15-12/h5-9,11H,3-4H2,1-2H3,(H,14,15)/t11-,19?/m1/s1 |
| InChIKey | CTWCZAZDRPKQPG-AMIJKRQISA-N |
| XLogP | 2.15 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine?
The IUPAC name of 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine (CID 59675555) is 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine.
What is the SMILES notation for 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine?
The canonical SMILES for 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine is CCOC1=NS(=O)N=C1N[C@H](CC)c1ccccc1.
What is the InChIKey of 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine?
The InChIKey is CTWCZAZDRPKQPG-AMIJKRQISA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-3-11(10-8-6-5-7-9-10)14-12-13(18-4-2)16-19(17)15-12/h5-9,11H,3-4H2,1-2H3,(H,14,15)/t11-,19?/m1/s1.
What are the key properties of 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine?
4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine has a molecular weight of 279.37 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-1-oxo-N-[(1R)-1-phenylpropyl]-1,2,5-thiadiazol-3-amine is sourced from PubChem (CID 59675555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).